C21H19N5O — CID 156547228
4-anilino-6-(1-ethylpyrazol-3-yl)quinoline-3-carboxamide (PubChem CID 156547228) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 4-anilino-6-(1-ethylpyrazol-3-yl)quinoline-3-carboxamide.
| Compound Name | 4-anilino-6-(1-ethylpyrazol-3-yl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 156547228 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-anilino-6-(1-ethylpyrazol-3-yl)quinoline-3-carboxamide |
| SMILES | CCn1ccc(-c2ccc3ncc(C(N)=O)c(Nc4ccccc4)c3c2)n1 |
| InChI | InChI=1S/C21H19N5O/c1-2-26-11-10-18(25-26)14-8-9-19-16(12-14)20(17(13-23-19)21(22)27)24-15-6-4-3-5-7-15/h3-13H,2H2,1H3,(H2,22,27)(H,23,24) |
| InChIKey | INJXSIBZSJJPJO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |