C30H31N5O4 — CID 149309124
tert-butyl N-[2-[[4-(4-anilino-3-carbamoylquinolin-7-yl)benzoyl]amino]ethyl]carbamate (PubChem CID 149309124) has the molecular formula C30H31N5O4 and a molecular weight of 525.61 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(4-anilino-3-carbamoylquinolin-7-yl)benzoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-(4-anilino-3-carbamoylquinolin-7-yl)benzoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 149309124 |
| Molecular Formula | C30H31N5O4 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | tert-butyl N-[2-[[4-(4-anilino-3-carbamoylquinolin-7-yl)benzoyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1ccc(-c2ccc3c(Nc4ccccc4)c(C(N)=O)cnc3c2)cc1 |
| InChI | InChI=1S/C30H31N5O4/c1-30(2,3)39-29(38)33-16-15-32-28(37)20-11-9-19(10-12-20)21-13-14-23-25(17-21)34-18-24(27(31)36)26(23)35-22-7-5-4-6-8-22/h4-14,17-18H,15-16H2,1-3H3,(H2,31,36)(H,32,37)(H,33,38)(H,34,35) |
| InChIKey | XYGKAGZIMLIZSO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|