C31H40N6O4 — CID 150364434
tert-butyl N-[6-[4-(4-anilino-3-carbamoylquinolin-6-yl)piperazin-1-yl]-6-oxohexyl]carbamate (PubChem CID 150364434) has the molecular formula C31H40N6O4 and a molecular weight of 560.70 g/mol. Its IUPAC name is tert-butyl N-[6-[4-(4-anilino-3-carbamoylquinolin-6-yl)piperazin-1-yl]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[6-[4-(4-anilino-3-carbamoylquinolin-6-yl)piperazin-1-yl]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 150364434 |
| Molecular Formula | C31H40N6O4 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | tert-butyl N-[6-[4-(4-anilino-3-carbamoylquinolin-6-yl)piperazin-1-yl]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)N1CCN(c2ccc3ncc(C(N)=O)c(Nc4ccccc4)c3c2)CC1 |
| InChI | InChI=1S/C31H40N6O4/c1-31(2,3)41-30(40)33-15-9-5-8-12-27(38)37-18-16-36(17-19-37)23-13-14-26-24(20-23)28(25(21-34-26)29(32)39)35-22-10-6-4-7-11-22/h4,6-7,10-11,13-14,20-21H,5,8-9,12,15-19H2,1-3H3,(H2,32,39)(H,33,40)(H,34,35) |
| InChIKey | GWJZNOUKDHPPRO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|