C23H33N5O5 — CID 170320365
tert-butyl N-[4-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperazin-1-yl]-4-oxobutyl]carbamate (PubChem CID 170320365) has the molecular formula C23H33N5O5 and a molecular weight of 459.55 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperazin-1-yl]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperazin-1-yl]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 170320365 |
| Molecular Formula | C23H33N5O5 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | tert-butyl N-[4-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperazin-1-yl]-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)N1CCN(c2ccc(N3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C23H33N5O5/c1-23(2,3)33-22(32)24-11-4-5-20(30)27-15-13-26(14-16-27)17-6-8-18(9-7-17)28-12-10-19(29)25-21(28)31/h6-9H,4-5,10-16H2,1-3H3,(H,24,32)(H,25,29,31) |
| InChIKey | DMLXDLDABWIBJX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|