C24H35N5O4 — CID 171774159
tert-butyl 4-[[(3R)-1-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]pyrrolidin-3-yl]methyl]piperazine-1-carboxylate (PubChem CID 171774159) has the molecular formula C24H35N5O4 and a molecular weight of 457.58 g/mol. Its IUPAC name is tert-butyl 4-[[(3R)-1-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]pyrrolidin-3-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(3R)-1-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]pyrrolidin-3-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171774159 |
| Molecular Formula | C24H35N5O4 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | tert-butyl 4-[[(3R)-1-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]pyrrolidin-3-yl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C[C@H]2CCN(c3ccc(N4CCC(=O)NC4=O)cc3)C2)CC1 |
| InChI | InChI=1S/C24H35N5O4/c1-24(2,3)33-23(32)27-14-12-26(13-15-27)16-18-8-10-28(17-18)19-4-6-20(7-5-19)29-11-9-21(30)25-22(29)31/h4-7,18H,8-17H2,1-3H3,(H,25,30,31)/t18-/m1/s1 |
| InChIKey | FTNGUWCEBHXFOS-GOSISDBHSA-N |
| XLogP | 2.51 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|