C22H33N5O3S — CID 21062835
tert-butyl N-[5-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-5-oxopentyl]carbamate (PubChem CID 21062835) has the molecular formula C22H33N5O3S and a molecular weight of 447.61 g/mol. Its IUPAC name is tert-butyl N-[5-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 21062835 |
| Molecular Formula | C22H33N5O3S |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | tert-butyl N-[5-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-5-oxopentyl]carbamate |
| SMILES | CCc1cc2c(N3CCN(C(=O)CCCCNC(=O)OC(C)(C)C)CC3)ncnc2s1 |
| InChI | InChI=1S/C22H33N5O3S/c1-5-16-14-17-19(24-15-25-20(17)31-16)27-12-10-26(11-13-27)18(28)8-6-7-9-23-21(29)30-22(2,3)4/h14-15H,5-13H2,1-4H3,(H,23,29) |
| InChIKey | PFDGXMZXWLGYMX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|