C23H31N7OS — CID 142220550
5-(N,2-diaminoanilino)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]pentan-1-one (PubChem CID 142220550) has the molecular formula C23H31N7OS and a molecular weight of 453.62 g/mol. Its IUPAC name is 5-(N,2-diaminoanilino)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-(N,2-diaminoanilino)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 142220550 |
| Molecular Formula | C23H31N7OS |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 5-(N,2-diaminoanilino)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]pentan-1-one |
| SMILES | CCc1cc2c(N3CCN(C(=O)CCCCN(N)c4ccccc4N)CC3)ncnc2s1 |
| InChI | InChI=1S/C23H31N7OS/c1-2-17-15-18-22(26-16-27-23(18)32-17)29-13-11-28(12-14-29)21(31)9-5-6-10-30(25)20-8-4-3-7-19(20)24/h3-4,7-8,15-16H,2,5-6,9-14,24-25H2,1H3 |
| InChIKey | ZRSNROGQXMOUMY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|