C19H21N5OS — CID 21062733
(4-aminophenyl)-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 21062733) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is (4-aminophenyl)-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | (4-aminophenyl)-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 21062733 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (4-aminophenyl)-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | CCc1cc2c(N3CCN(C(=O)c4ccc(N)cc4)CC3)ncnc2s1 |
| InChI | InChI=1S/C19H21N5OS/c1-2-15-11-16-17(21-12-22-18(16)26-15)23-7-9-24(10-8-23)19(25)13-3-5-14(20)6-4-13/h3-6,11-12H,2,7-10,20H2,1H3 |
| InChIKey | RTGIOKRMHQYIKR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|