C21H20Cl2N4OS — CID 39073185
(E)-3-(2,4-dichlorophenyl)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 39073185) has the molecular formula C21H20Cl2N4OS and a molecular weight of 447.39 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 39073185 |
| Molecular Formula | C21H20Cl2N4OS |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCc1cc2c(N3CCN(C(=O)/C=C/c4ccc(Cl)cc4Cl)CC3)ncnc2s1 |
| InChI | InChI=1S/C21H20Cl2N4OS/c1-2-16-12-17-20(24-13-25-21(17)29-16)27-9-7-26(8-10-27)19(28)6-4-14-3-5-15(22)11-18(14)23/h3-6,11-13H,2,7-10H2,1H3/b6-4+ |
| InChIKey | MEWGBKCWZDULBC-GQCTYLIASA-N |
| XLogP | 4.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|