C18H18Cl2N4O — CID 108755343
(E)-3-(2,4-dichlorophenyl)-1-[4-(6-methylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 108755343) has the molecular formula C18H18Cl2N4O and a molecular weight of 377.28 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-1-[4-(6-methylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-1-[4-(6-methylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 108755343 |
| Molecular Formula | C18H18Cl2N4O |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-1-[4-(6-methylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1cc(N2CCN(C(=O)/C=C/c3ccc(Cl)cc3Cl)CC2)ncn1 |
| InChI | InChI=1S/C18H18Cl2N4O/c1-13-10-17(22-12-21-13)23-6-8-24(9-7-23)18(25)5-3-14-2-4-15(19)11-16(14)20/h2-5,10-12H,6-9H2,1H3/b5-3+ |
| InChIKey | BUKOQENQQDXOJB-HWKANZROSA-N |
| XLogP | 3.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|