C22H26ClN5O — CID 122343110
(E)-3-(4-chlorophenyl)-1-[4-(6-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 122343110) has the molecular formula C22H26ClN5O and a molecular weight of 411.94 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[4-(6-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[4-(6-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122343110 |
| Molecular Formula | C22H26ClN5O |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[4-(6-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)N1CCN(c2cc(N3CCCCC3)ncn2)CC1 |
| InChI | InChI=1S/C22H26ClN5O/c23-19-7-4-18(5-8-19)6-9-22(29)28-14-12-27(13-15-28)21-16-20(24-17-25-21)26-10-2-1-3-11-26/h4-9,16-17H,1-3,10-15H2/b9-6+ |
| InChIKey | CYNPARUPWLIYHZ-RMKNXTFCSA-N |
| XLogP | 3.48 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|