C24H20Cl2N6O — CID 108771347
(E)-3-(4-chlorophenyl)-1-[4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 108771347) has the molecular formula C24H20Cl2N6O and a molecular weight of 479.37 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 108771347 |
| Molecular Formula | C24H20Cl2N6O |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)N1CCN(c2ncnc3c2cnn3-c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H20Cl2N6O/c25-18-7-4-17(5-8-18)6-9-22(33)30-10-12-31(13-11-30)23-21-15-29-32(24(21)28-16-27-23)20-3-1-2-19(26)14-20/h1-9,14-16H,10-13H2/b9-6+ |
| InChIKey | KLPHLYYUBWGANZ-RMKNXTFCSA-N |
| XLogP | 4.48 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|