C18H18Cl2N6O — CID 108771368
3-chloro-1-[4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]propan-1-one (PubChem CID 108771368) has the molecular formula C18H18Cl2N6O and a molecular weight of 405.29 g/mol. Its IUPAC name is 3-chloro-1-[4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-chloro-1-[4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 108771368 |
| Molecular Formula | C18H18Cl2N6O |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 3-chloro-1-[4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCCl)N1CCN(c2ncnc3c2cnn3-c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H18Cl2N6O/c19-5-4-16(27)24-6-8-25(9-7-24)17-15-11-23-26(18(15)22-12-21-17)14-3-1-2-13(20)10-14/h1-3,10-12H,4-9H2 |
| InChIKey | JYWMOQKAYBQQAW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|