C22H17Cl2N7O3 — CID 108749471
(4-chloro-3-nitrophenyl)-[4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 108749471) has the molecular formula C22H17Cl2N7O3 and a molecular weight of 498.33 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-[4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-[4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 108749471 |
| Molecular Formula | C22H17Cl2N7O3 |
| Molecular Weight | 498.33 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-[4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N1CCN(c2ncnc3c2cnn3-c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H17Cl2N7O3/c23-15-2-1-3-16(11-15)30-21-17(12-27-30)20(25-13-26-21)28-6-8-29(9-7-28)22(32)14-4-5-18(24)19(10-14)31(33)34/h1-5,10-13H,6-9H2 |
| InChIKey | JZYPEDHFZQNVRU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|