C21H24N8O3 — CID 16962659
[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone (PubChem CID 16962659) has the molecular formula C21H24N8O3 and a molecular weight of 436.48 g/mol. Its IUPAC name is [4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone.
| Compound Name | [4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 16962659 |
| Molecular Formula | C21H24N8O3 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | [4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone |
| SMILES | Cn1ncc2c(N3CCN(C(=O)c4ccc(N5CCCC5)c([N+](=O)[O-])c4)CC3)ncnc21 |
| InChI | InChI=1S/C21H24N8O3/c1-25-19-16(13-24-25)20(23-14-22-19)27-8-10-28(11-9-27)21(30)15-4-5-17(18(12-15)29(31)32)26-6-2-3-7-26/h4-5,12-14H,2-3,6-11H2,1H3 |
| InChIKey | WSEBFVIPMRAIGX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 113.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|