C18H19N7O3 — CID 16962649
(3-methyl-2-nitrophenyl)-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 16962649) has the molecular formula C18H19N7O3 and a molecular weight of 381.40 g/mol. Its IUPAC name is (3-methyl-2-nitrophenyl)-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | (3-methyl-2-nitrophenyl)-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 16962649 |
| Molecular Formula | C18H19N7O3 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (3-methyl-2-nitrophenyl)-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | Cc1cccc(C(=O)N2CCN(c3ncnc4c3cnn4C)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N7O3/c1-12-4-3-5-13(15(12)25(27)28)18(26)24-8-6-23(7-9-24)17-14-10-21-22(2)16(14)19-11-20-17/h3-5,10-11H,6-9H2,1-2H3 |
| InChIKey | GYSJHCGQALFGFF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|