C22H19ClN8O3 — CID 41245481
[4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]-(4-chloro-3-nitrophenyl)methanone (PubChem CID 41245481) has the molecular formula C22H19ClN8O3 and a molecular weight of 478.90 g/mol. Its IUPAC name is [4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]-(4-chloro-3-nitrophenyl)methanone.
| Compound Name | [4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]-(4-chloro-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 41245481 |
| Molecular Formula | C22H19ClN8O3 |
| Molecular Weight | 478.90 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]-(4-chloro-3-nitrophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N1CCN(c2ncnc3c2nnn3Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H19ClN8O3/c23-17-7-6-16(12-18(17)31(33)34)22(32)29-10-8-28(9-11-29)20-19-21(25-14-24-20)30(27-26-19)13-15-4-2-1-3-5-15/h1-7,12,14H,8-11,13H2 |
| InChIKey | FNNPBCKJTXFJLO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 123.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.90 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|