C22H20IN7O — CID 16811420
[4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]-(2-iodophenyl)methanone (PubChem CID 16811420) has the molecular formula C22H20IN7O and a molecular weight of 525.35 g/mol. Its IUPAC name is [4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]-(2-iodophenyl)methanone.
| Compound Name | [4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 16811420 |
| Molecular Formula | C22H20IN7O |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | [4-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]-(2-iodophenyl)methanone |
| SMILES | O=C(c1ccccc1I)N1CCN(c2ncnc3c2nnn3Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H20IN7O/c23-18-9-5-4-8-17(18)22(31)29-12-10-28(11-13-29)20-19-21(25-15-24-20)30(27-26-19)14-16-6-2-1-3-7-16/h1-9,15H,10-14H2 |
| InChIKey | OTLULYXWYACANP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|