C17H14ClN3O3 — CID 3423787
(2-benzyl-4,5-dihydroimidazol-1-yl)-(4-chloro-3-nitrophenyl)methanone (PubChem CID 3423787) has the molecular formula C17H14ClN3O3 and a molecular weight of 343.77 g/mol. Its IUPAC name is (2-benzyl-4,5-dihydroimidazol-1-yl)-(4-chloro-3-nitrophenyl)methanone.
| Compound Name | (2-benzyl-4,5-dihydroimidazol-1-yl)-(4-chloro-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 3423787 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (2-benzyl-4,5-dihydroimidazol-1-yl)-(4-chloro-3-nitrophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N1CCN=C1Cc1ccccc1 |
| InChI | InChI=1S/C17H14ClN3O3/c18-14-7-6-13(11-15(14)21(23)24)17(22)20-9-8-19-16(20)10-12-4-2-1-3-5-12/h1-7,11H,8-10H2 |
| InChIKey | XHIBWSXNUPUDGS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|