C21H17N3O3 — CID 3294087
(4-methyl-3-nitrophenyl)-(2-naphthalen-1-yl-4,5-dihydroimidazol-1-yl)methanone (PubChem CID 3294087) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is (4-methyl-3-nitrophenyl)-(2-naphthalen-1-yl-4,5-dihydroimidazol-1-yl)methanone.
| Compound Name | (4-methyl-3-nitrophenyl)-(2-naphthalen-1-yl-4,5-dihydroimidazol-1-yl)methanone |
|---|---|
| PubChem CID | 3294087 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (4-methyl-3-nitrophenyl)-(2-naphthalen-1-yl-4,5-dihydroimidazol-1-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCN=C2c2cccc3ccccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17N3O3/c1-14-9-10-16(13-19(14)24(26)27)21(25)23-12-11-22-20(23)18-8-4-6-15-5-2-3-7-17(15)18/h2-10,13H,11-12H2,1H3 |
| InChIKey | LUKMCZFAUPHAJZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|