C22H22N4O3 — CID 16962419
(4-methyl-3-nitrophenyl)-[4-(quinolin-8-ylmethyl)piperazin-1-yl]methanone (PubChem CID 16962419) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is (4-methyl-3-nitrophenyl)-[4-(quinolin-8-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (4-methyl-3-nitrophenyl)-[4-(quinolin-8-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 16962419 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (4-methyl-3-nitrophenyl)-[4-(quinolin-8-ylmethyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(Cc3cccc4cccnc34)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H22N4O3/c1-16-7-8-18(14-20(16)26(28)29)22(27)25-12-10-24(11-13-25)15-19-5-2-4-17-6-3-9-23-21(17)19/h2-9,14H,10-13,15H2,1H3 |
| InChIKey | PAJCYCXSDWJPLI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|