C22H25N5O3 — CID 112770934
[4-[(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]-(4-methyl-3-nitrophenyl)methanone (PubChem CID 112770934) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is [4-[(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]-(4-methyl-3-nitrophenyl)methanone.
| Compound Name | [4-[(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]-(4-methyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 112770934 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | [4-[(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]-(4-methyl-3-nitrophenyl)methanone |
| SMILES | Cc1ccn2c(CN3CCN(C(=O)c4ccc(C)c([N+](=O)[O-])c4)CC3)c(C)nc2c1 |
| InChI | InChI=1S/C22H25N5O3/c1-15-6-7-26-20(17(3)23-21(26)12-15)14-24-8-10-25(11-9-24)22(28)18-5-4-16(2)19(13-18)27(29)30/h4-7,12-13H,8-11,14H2,1-3H3 |
| InChIKey | QCIFOODBXMERRG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|