C23H28N6O3 — CID 112809154
1-[4-[(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]-3-(2-nitroanilino)propan-1-one (PubChem CID 112809154) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is 1-[4-[(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]-3-(2-nitroanilino)propan-1-one.
| Compound Name | 1-[4-[(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]-3-(2-nitroanilino)propan-1-one |
|---|---|
| PubChem CID | 112809154 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 1-[4-[(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]-3-(2-nitroanilino)propan-1-one |
| SMILES | Cc1ccn2c(CN3CCN(C(=O)CCNc4ccccc4[N+](=O)[O-])CC3)c(C)nc2c1 |
| InChI | InChI=1S/C23H28N6O3/c1-17-8-10-28-21(18(2)25-22(28)15-17)16-26-11-13-27(14-12-26)23(30)7-9-24-19-5-3-4-6-20(19)29(31)32/h3-6,8,10,15,24H,7,9,11-14,16H2,1-2H3 |
| InChIKey | RKHCULPGPHEDOT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|