C10H7ClN2O3S2 — CID 4749460
(4-chloro-3-nitrophenyl)-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone (PubChem CID 4749460) has the molecular formula C10H7ClN2O3S2 and a molecular weight of 302.76 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 4749460 |
| Molecular Formula | C10H7ClN2O3S2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N1CCSC1=S |
| InChI | InChI=1S/C10H7ClN2O3S2/c11-7-2-1-6(5-8(7)13(15)16)9(14)12-3-4-18-10(12)17/h1-2,5H,3-4H2 |
| InChIKey | OMAQCCSUVURYEI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|