C16H11ClF2N2O3 — CID 55671768
(4-chloro-3-nitrophenyl)-(5,7-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 55671768) has the molecular formula C16H11ClF2N2O3 and a molecular weight of 352.72 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-(5,7-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-(5,7-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 55671768 |
| Molecular Formula | C16H11ClF2N2O3 |
| Molecular Weight | 352.72 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-(5,7-difluoro-3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N1CCCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C16H11ClF2N2O3/c17-12-4-3-9(6-15(12)21(23)24)16(22)20-5-1-2-11-13(19)7-10(18)8-14(11)20/h3-4,6-8H,1-2,5H2 |
| InChIKey | ANQWIVRZZDIYPD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.72 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|