C16H11F5N2O4S — CID 156859285
5,7-difluoro-1-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-3,4-dihydro-2H-quinoline (PubChem CID 156859285) has the molecular formula C16H11F5N2O4S and a molecular weight of 422.33 g/mol. Its IUPAC name is 5,7-difluoro-1-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-3,4-dihydro-2H-quinoline.
| Compound Name | 5,7-difluoro-1-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 156859285 |
| Molecular Formula | C16H11F5N2O4S |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 5,7-difluoro-1-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-3,4-dihydro-2H-quinoline |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)C(F)(F)F)ccc1N1CCCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C16H11F5N2O4S/c17-9-6-12(18)11-2-1-5-22(14(11)7-9)13-4-3-10(8-15(13)23(24)25)28(26,27)16(19,20)21/h3-4,6-8H,1-2,5H2 |
| InChIKey | SHVSUGXAASVALE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|