C15H11F3N2O4S — CID 133300024
1-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-6-fluoro-2,3-dihydroindole (PubChem CID 133300024) has the molecular formula C15H11F3N2O4S and a molecular weight of 372.32 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-6-fluoro-2,3-dihydroindole.
| Compound Name | 1-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-6-fluoro-2,3-dihydroindole |
|---|---|
| PubChem CID | 133300024 |
| Molecular Formula | C15H11F3N2O4S |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 1-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-6-fluoro-2,3-dihydroindole |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)C(F)F)ccc1N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C15H11F3N2O4S/c16-10-2-1-9-5-6-19(13(9)7-10)12-4-3-11(8-14(12)20(21)22)25(23,24)15(17)18/h1-4,7-8,15H,5-6H2 |
| InChIKey | QDKDLDGWYSEUOX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|