C18H14ClF2N3O4S — CID 133297605
8-chloro-2-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 133297605) has the molecular formula C18H14ClF2N3O4S and a molecular weight of 441.84 g/mol. Its IUPAC name is 8-chloro-2-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-chloro-2-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 133297605 |
| Molecular Formula | C18H14ClF2N3O4S |
| Molecular Weight | 441.84 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 8-chloro-2-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)C(F)F)ccc1N1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C18H14ClF2N3O4S/c19-10-1-3-14-12(7-10)13-9-23(6-5-15(13)22-14)16-4-2-11(8-17(16)24(25)26)29(27,28)18(20)21/h1-4,7-8,18,22H,5-6,9H2 |
| InChIKey | AQAQJWDBWOBXIM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.84 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|