C18H16FN3O4S — CID 133393379
8-fluoro-2-(3-methylsulfonyl-2-nitrophenyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 133393379) has the molecular formula C18H16FN3O4S and a molecular weight of 389.41 g/mol. Its IUPAC name is 8-fluoro-2-(3-methylsulfonyl-2-nitrophenyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-fluoro-2-(3-methylsulfonyl-2-nitrophenyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 133393379 |
| Molecular Formula | C18H16FN3O4S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 8-fluoro-2-(3-methylsulfonyl-2-nitrophenyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | CS(=O)(=O)c1cccc(N2CCc3[nH]c4ccc(F)cc4c3C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16FN3O4S/c1-27(25,26)17-4-2-3-16(18(17)22(23)24)21-8-7-15-13(10-21)12-9-11(19)5-6-14(12)20-15/h2-6,9,20H,7-8,10H2,1H3 |
| InChIKey | ULWJNRLMUPZKNL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|