C13H17F2N3O4S — CID 133393836
1-(2,2-difluoroethyl)-4-(3-methylsulfonyl-2-nitrophenyl)piperazine (PubChem CID 133393836) has the molecular formula C13H17F2N3O4S and a molecular weight of 349.36 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-(3-methylsulfonyl-2-nitrophenyl)piperazine.
| Compound Name | 1-(2,2-difluoroethyl)-4-(3-methylsulfonyl-2-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 133393836 |
| Molecular Formula | C13H17F2N3O4S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-(3-methylsulfonyl-2-nitrophenyl)piperazine |
| SMILES | CS(=O)(=O)c1cccc(N2CCN(CC(F)F)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17F2N3O4S/c1-23(21,22)11-4-2-3-10(13(11)18(19)20)17-7-5-16(6-8-17)9-12(14)15/h2-4,12H,5-9H2,1H3 |
| InChIKey | QSNMPQHKJKWJRQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|