C18H24ClN5O4S — CID 133413856
1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-4-(3-methylsulfonyl-2-nitrophenyl)piperazine (PubChem CID 133413856) has the molecular formula C18H24ClN5O4S and a molecular weight of 441.94 g/mol. Its IUPAC name is 1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-4-(3-methylsulfonyl-2-nitrophenyl)piperazine.
| Compound Name | 1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-4-(3-methylsulfonyl-2-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 133413856 |
| Molecular Formula | C18H24ClN5O4S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-4-(3-methylsulfonyl-2-nitrophenyl)piperazine |
| SMILES | CCc1nn(C)c(Cl)c1CN1CCN(c2cccc(S(C)(=O)=O)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H24ClN5O4S/c1-4-14-13(18(19)21(2)20-14)12-22-8-10-23(11-9-22)15-6-5-7-16(29(3,27)28)17(15)24(25)26/h5-7H,4,8-12H2,1-3H3 |
| InChIKey | KZOKPQSVMXSSPY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 101.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|