C19H17N5O6S — CID 133393395
2-(furan-2-yl)-5-[4-(3-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-1,3-oxazole-4-carbonitrile (PubChem CID 133393395) has the molecular formula C19H17N5O6S and a molecular weight of 443.44 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[4-(3-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-(furan-2-yl)-5-[4-(3-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 133393395 |
| Molecular Formula | C19H17N5O6S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 2-(furan-2-yl)-5-[4-(3-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-1,3-oxazole-4-carbonitrile |
| SMILES | CS(=O)(=O)c1cccc(N2CCN(c3oc(-c4ccco4)nc3C#N)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17N5O6S/c1-31(27,28)16-6-2-4-14(17(16)24(25)26)22-7-9-23(10-8-22)19-13(12-20)21-18(30-19)15-5-3-11-29-15/h2-6,11H,7-10H2,1H3 |
| InChIKey | QCBBLLRRYUIBCK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 146.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|