C19H16N6O5 — CID 55618175
5-[4-(4-amino-3-nitrobenzoyl)piperazin-1-yl]-2-(furan-2-yl)-1,3-oxazole-4-carbonitrile (PubChem CID 55618175) has the molecular formula C19H16N6O5 and a molecular weight of 408.37 g/mol. Its IUPAC name is 5-[4-(4-amino-3-nitrobenzoyl)piperazin-1-yl]-2-(furan-2-yl)-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[4-(4-amino-3-nitrobenzoyl)piperazin-1-yl]-2-(furan-2-yl)-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 55618175 |
| Molecular Formula | C19H16N6O5 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 5-[4-(4-amino-3-nitrobenzoyl)piperazin-1-yl]-2-(furan-2-yl)-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(-c2ccco2)oc1N1CCN(C(=O)c2ccc(N)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C19H16N6O5/c20-11-14-19(30-17(22-14)16-2-1-9-29-16)24-7-5-23(6-8-24)18(26)12-3-4-13(21)15(10-12)25(27)28/h1-4,9-10H,5-8,21H2 |
| InChIKey | NRKQZLWMNRYMHD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 155.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|