C22H17N7O5 — CID 38495098
2-(furan-2-yl)-5-[4-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperazin-1-yl]-1,3-oxazole-4-carbonitrile (PubChem CID 38495098) has the molecular formula C22H17N7O5 and a molecular weight of 459.42 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[4-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperazin-1-yl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-(furan-2-yl)-5-[4-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperazin-1-yl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 38495098 |
| Molecular Formula | C22H17N7O5 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 2-(furan-2-yl)-5-[4-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperazin-1-yl]-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(-c2ccco2)oc1N1CCN(C(=O)c2ccn(-c3cccc([N+](=O)[O-])c3)n2)CC1 |
| InChI | InChI=1S/C22H17N7O5/c23-14-18-22(34-20(24-18)19-5-2-12-33-19)27-10-8-26(9-11-27)21(30)17-6-7-28(25-17)15-3-1-4-16(13-15)29(31)32/h1-7,12-13H,8-11H2 |
| InChIKey | QKVXTQFDSSKIRW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 147.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|