C21H17N5O5 — CID 16647511
5-[4-(furan-2-carbonyl)piperazin-1-yl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazole-4-carbonitrile (PubChem CID 16647511) has the molecular formula C21H17N5O5 and a molecular weight of 419.40 g/mol. Its IUPAC name is 5-[4-(furan-2-carbonyl)piperazin-1-yl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[4-(furan-2-carbonyl)piperazin-1-yl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 16647511 |
| Molecular Formula | C21H17N5O5 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 5-[4-(furan-2-carbonyl)piperazin-1-yl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(/C=C/c2cccc([N+](=O)[O-])c2)oc1N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C21H17N5O5/c22-14-17-21(25-10-8-24(9-11-25)20(27)18-5-2-12-30-18)31-19(23-17)7-6-15-3-1-4-16(13-15)26(28)29/h1-7,12-13H,8-11H2/b7-6+ |
| InChIKey | SWTXYSNFCJHMAU-VOTSOKGWSA-N |
| XLogP | 3.18 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|