C27H27N5O5 — CID 16647346
5-[4-(4-butoxybenzoyl)piperazin-1-yl]-2-[(E)-2-(4-nitrophenyl)ethenyl]-1,3-oxazole-4-carbonitrile (PubChem CID 16647346) has the molecular formula C27H27N5O5 and a molecular weight of 501.54 g/mol. Its IUPAC name is 5-[4-(4-butoxybenzoyl)piperazin-1-yl]-2-[(E)-2-(4-nitrophenyl)ethenyl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[4-(4-butoxybenzoyl)piperazin-1-yl]-2-[(E)-2-(4-nitrophenyl)ethenyl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 16647346 |
| Molecular Formula | C27H27N5O5 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 5-[4-(4-butoxybenzoyl)piperazin-1-yl]-2-[(E)-2-(4-nitrophenyl)ethenyl]-1,3-oxazole-4-carbonitrile |
| SMILES | CCCCOc1ccc(C(=O)N2CCN(c3oc(/C=C/c4ccc([N+](=O)[O-])cc4)nc3C#N)CC2)cc1 |
| InChI | InChI=1S/C27H27N5O5/c1-2-3-18-36-23-11-7-21(8-12-23)26(33)30-14-16-31(17-15-30)27-24(19-28)29-25(37-27)13-6-20-4-9-22(10-5-20)32(34)35/h4-13H,2-3,14-18H2,1H3/b13-6+ |
| InChIKey | MKWDIAOEYXJOAL-AWNIVKPZSA-N |
| XLogP | 4.77 |
| TPSA | 125.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|