C23H22N6O4 — CID 78864573
2-(4-methoxyphenyl)-2-[4-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperazin-1-yl]acetonitrile (PubChem CID 78864573) has the molecular formula C23H22N6O4 and a molecular weight of 446.47 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-[4-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperazin-1-yl]acetonitrile.
| Compound Name | 2-(4-methoxyphenyl)-2-[4-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 78864573 |
| Molecular Formula | C23H22N6O4 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-[4-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperazin-1-yl]acetonitrile |
| SMILES | COc1ccc(C(C#N)N2CCN(C(=O)c3ccn(-c4cccc([N+](=O)[O-])c4)n3)CC2)cc1 |
| InChI | InChI=1S/C23H22N6O4/c1-33-20-7-5-17(6-8-20)22(16-24)26-11-13-27(14-12-26)23(30)21-9-10-28(25-21)18-3-2-4-19(15-18)29(31)32/h2-10,15,22H,11-14H2,1H3 |
| InChIKey | GFGUSHVLYQRFOB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 117.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|