C22H22N6O2 — CID 78861545
2-(4-methoxyphenyl)-2-[4-(1-phenyltriazole-4-carbonyl)piperazin-1-yl]acetonitrile (PubChem CID 78861545) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-[4-(1-phenyltriazole-4-carbonyl)piperazin-1-yl]acetonitrile.
| Compound Name | 2-(4-methoxyphenyl)-2-[4-(1-phenyltriazole-4-carbonyl)piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 78861545 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-[4-(1-phenyltriazole-4-carbonyl)piperazin-1-yl]acetonitrile |
| SMILES | COc1ccc(C(C#N)N2CCN(C(=O)c3cn(-c4ccccc4)nn3)CC2)cc1 |
| InChI | InChI=1S/C22H22N6O2/c1-30-19-9-7-17(8-10-19)21(15-23)26-11-13-27(14-12-26)22(29)20-16-28(25-24-20)18-5-3-2-4-6-18/h2-10,16,21H,11-14H2,1H3 |
| InChIKey | RNMGUKIJYQTKKI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 87.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |