C20H22N4O2 — CID 110349977
4-[cyano-(4-methoxyphenyl)methyl]-N-phenylpiperazine-1-carboxamide (PubChem CID 110349977) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[cyano-(4-methoxyphenyl)methyl]-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-[cyano-(4-methoxyphenyl)methyl]-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 110349977 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 4-[cyano-(4-methoxyphenyl)methyl]-N-phenylpiperazine-1-carboxamide |
| SMILES | COc1ccc(C(C#N)N2CCN(C(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-26-18-9-7-16(8-10-18)19(15-21)23-11-13-24(14-12-23)20(25)22-17-5-3-2-4-6-17/h2-10,19H,11-14H2,1H3,(H,22,25) |
| InChIKey | JEEKZFTVWARMJM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |