C22H20N4O3 — CID 94654381
2-(furan-2-yl)-5-[4-[(E)-3-phenylbut-2-enoyl]piperazin-1-yl]-1,3-oxazole-4-carbonitrile (PubChem CID 94654381) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[4-[(E)-3-phenylbut-2-enoyl]piperazin-1-yl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-(furan-2-yl)-5-[4-[(E)-3-phenylbut-2-enoyl]piperazin-1-yl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 94654381 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-(furan-2-yl)-5-[4-[(E)-3-phenylbut-2-enoyl]piperazin-1-yl]-1,3-oxazole-4-carbonitrile |
| SMILES | C/C(=C\C(=O)N1CCN(c2oc(-c3ccco3)nc2C#N)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H20N4O3/c1-16(17-6-3-2-4-7-17)14-20(27)25-9-11-26(12-10-25)22-18(15-23)24-21(29-22)19-8-5-13-28-19/h2-8,13-14H,9-12H2,1H3/b16-14+ |
| InChIKey | SQOAYDXPTCKTBW-JQIJEIRASA-N |
| XLogP | 3.56 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|