C23H22N4O4 — CID 55569275
5-[4-[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]piperazin-1-yl]-2-(furan-2-yl)-1,3-oxazole-4-carbonitrile (PubChem CID 55569275) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 5-[4-[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]piperazin-1-yl]-2-(furan-2-yl)-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[4-[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]piperazin-1-yl]-2-(furan-2-yl)-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 55569275 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 5-[4-[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]piperazin-1-yl]-2-(furan-2-yl)-1,3-oxazole-4-carbonitrile |
| SMILES | CCOc1ccccc1/C=C/C(=O)N1CCN(c2oc(-c3ccco3)nc2C#N)CC1 |
| InChI | InChI=1S/C23H22N4O4/c1-2-29-19-7-4-3-6-17(19)9-10-21(28)26-11-13-27(14-12-26)23-18(16-24)25-22(31-23)20-8-5-15-30-20/h3-10,15H,2,11-14H2,1H3/b10-9+ |
| InChIKey | NQTIJAFJFWRXBL-MDZDMXLPSA-N |
| XLogP | 3.57 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|