C22H19N5O8 — CID 55609286
methyl 4-[2-[4-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperazin-1-yl]-2-oxoethoxy]-3-nitrobenzoate (PubChem CID 55609286) has the molecular formula C22H19N5O8 and a molecular weight of 481.42 g/mol. Its IUPAC name is methyl 4-[2-[4-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperazin-1-yl]-2-oxoethoxy]-3-nitrobenzoate.
| Compound Name | methyl 4-[2-[4-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperazin-1-yl]-2-oxoethoxy]-3-nitrobenzoate |
|---|---|
| PubChem CID | 55609286 |
| Molecular Formula | C22H19N5O8 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | methyl 4-[2-[4-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperazin-1-yl]-2-oxoethoxy]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)N2CCN(c3oc(-c4ccco4)nc3C#N)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H19N5O8/c1-32-22(29)14-4-5-17(16(11-14)27(30)31)34-13-19(28)25-6-8-26(9-7-25)21-15(12-23)24-20(35-21)18-3-2-10-33-18/h2-5,10-11H,6-9,13H2,1H3 |
| InChIKey | GSNATIGFDMITGV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 165.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|