C19H29N3O5S — CID 133432569
2,6-dimethyl-4-[[1-(3-methylsulfonyl-2-nitrophenyl)piperidin-4-yl]methyl]morpholine (PubChem CID 133432569) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is 2,6-dimethyl-4-[[1-(3-methylsulfonyl-2-nitrophenyl)piperidin-4-yl]methyl]morpholine.
| Compound Name | 2,6-dimethyl-4-[[1-(3-methylsulfonyl-2-nitrophenyl)piperidin-4-yl]methyl]morpholine |
|---|---|
| PubChem CID | 133432569 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2,6-dimethyl-4-[[1-(3-methylsulfonyl-2-nitrophenyl)piperidin-4-yl]methyl]morpholine |
| SMILES | CC1CN(CC2CCN(c3cccc(S(C)(=O)=O)c3[N+](=O)[O-])CC2)CC(C)O1 |
| InChI | InChI=1S/C19H29N3O5S/c1-14-11-20(12-15(2)27-14)13-16-7-9-21(10-8-16)17-5-4-6-18(28(3,25)26)19(17)22(23)24/h4-6,14-16H,7-13H2,1-3H3 |
| InChIKey | BROAVOQOTGBCJE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|