C22H35N3O4 — CID 133447919
2,6-dimethyl-4-[[1-[3-[(2-methylpropan-2-yl)oxy]-4-nitrophenyl]piperidin-4-yl]methyl]morpholine (PubChem CID 133447919) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2,6-dimethyl-4-[[1-[3-[(2-methylpropan-2-yl)oxy]-4-nitrophenyl]piperidin-4-yl]methyl]morpholine.
| Compound Name | 2,6-dimethyl-4-[[1-[3-[(2-methylpropan-2-yl)oxy]-4-nitrophenyl]piperidin-4-yl]methyl]morpholine |
|---|---|
| PubChem CID | 133447919 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 2,6-dimethyl-4-[[1-[3-[(2-methylpropan-2-yl)oxy]-4-nitrophenyl]piperidin-4-yl]methyl]morpholine |
| SMILES | CC1CN(CC2CCN(c3ccc([N+](=O)[O-])c(OC(C)(C)C)c3)CC2)CC(C)O1 |
| InChI | InChI=1S/C22H35N3O4/c1-16-13-23(14-17(2)28-16)15-18-8-10-24(11-9-18)19-6-7-20(25(26)27)21(12-19)29-22(3,4)5/h6-7,12,16-18H,8-11,13-15H2,1-5H3 |
| InChIKey | AAVFWJXSZFSBLD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|