C20H30N4O6 — CID 133447834
[4-[4-[(2,6-dimethylmorpholin-4-yl)methyl]piperidin-1-yl]-2-methyl-3,5-dinitrophenyl]methanol (PubChem CID 133447834) has the molecular formula C20H30N4O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is [4-[4-[(2,6-dimethylmorpholin-4-yl)methyl]piperidin-1-yl]-2-methyl-3,5-dinitrophenyl]methanol.
| Compound Name | [4-[4-[(2,6-dimethylmorpholin-4-yl)methyl]piperidin-1-yl]-2-methyl-3,5-dinitrophenyl]methanol |
|---|---|
| PubChem CID | 133447834 |
| Molecular Formula | C20H30N4O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [4-[4-[(2,6-dimethylmorpholin-4-yl)methyl]piperidin-1-yl]-2-methyl-3,5-dinitrophenyl]methanol |
| SMILES | Cc1c(CO)cc([N+](=O)[O-])c(N2CCC(CN3CC(C)OC(C)C3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H30N4O6/c1-13-9-21(10-14(2)30-13)11-16-4-6-22(7-5-16)20-18(23(26)27)8-17(12-25)15(3)19(20)24(28)29/h8,13-14,16,25H,4-7,9-12H2,1-3H3 |
| InChIKey | YLOILSSONOFCSU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|