C17H25N3O5 — CID 133332906
[2-methyl-4-(3-methyl-3-propylpiperidin-1-yl)-3,5-dinitrophenyl]methanol (PubChem CID 133332906) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is [2-methyl-4-(3-methyl-3-propylpiperidin-1-yl)-3,5-dinitrophenyl]methanol.
| Compound Name | [2-methyl-4-(3-methyl-3-propylpiperidin-1-yl)-3,5-dinitrophenyl]methanol |
|---|---|
| PubChem CID | 133332906 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [2-methyl-4-(3-methyl-3-propylpiperidin-1-yl)-3,5-dinitrophenyl]methanol |
| SMILES | CCCC1(C)CCCN(c2c([N+](=O)[O-])cc(CO)c(C)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H25N3O5/c1-4-6-17(3)7-5-8-18(11-17)16-14(19(22)23)9-13(10-21)12(2)15(16)20(24)25/h9,21H,4-8,10-11H2,1-3H3 |
| InChIKey | KKJUZWQYZALKLS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|