C16H23N3O6 — CID 133343989
2-[[4-(hydroxymethyl)-3-methyl-2,6-dinitroanilino]methyl]-2-methylcyclohexan-1-ol (PubChem CID 133343989) has the molecular formula C16H23N3O6 and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-[[4-(hydroxymethyl)-3-methyl-2,6-dinitroanilino]methyl]-2-methylcyclohexan-1-ol.
| Compound Name | 2-[[4-(hydroxymethyl)-3-methyl-2,6-dinitroanilino]methyl]-2-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 133343989 |
| Molecular Formula | C16H23N3O6 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-[[4-(hydroxymethyl)-3-methyl-2,6-dinitroanilino]methyl]-2-methylcyclohexan-1-ol |
| SMILES | Cc1c(CO)cc([N+](=O)[O-])c(NCC2(C)CCCCC2O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H23N3O6/c1-10-11(8-20)7-12(18(22)23)14(15(10)19(24)25)17-9-16(2)6-4-3-5-13(16)21/h7,13,17,20-21H,3-6,8-9H2,1-2H3 |
| InChIKey | AXGNKYUIAMRZMH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|