C19H21N3O5 — CID 133386615
[4-[(3,3-dimethyl-1,2-dihydroinden-1-yl)amino]-2-methyl-3,5-dinitrophenyl]methanol (PubChem CID 133386615) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is [4-[(3,3-dimethyl-1,2-dihydroinden-1-yl)amino]-2-methyl-3,5-dinitrophenyl]methanol.
| Compound Name | [4-[(3,3-dimethyl-1,2-dihydroinden-1-yl)amino]-2-methyl-3,5-dinitrophenyl]methanol |
|---|---|
| PubChem CID | 133386615 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [4-[(3,3-dimethyl-1,2-dihydroinden-1-yl)amino]-2-methyl-3,5-dinitrophenyl]methanol |
| SMILES | Cc1c(CO)cc([N+](=O)[O-])c(NC2CC(C)(C)c3ccccc32)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21N3O5/c1-11-12(10-23)8-16(21(24)25)17(18(11)22(26)27)20-15-9-19(2,3)14-7-5-4-6-13(14)15/h4-8,15,20,23H,9-10H2,1-3H3 |
| InChIKey | GDZGUZGAMRFLPL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|