C16H21N3O7 — CID 99780718
[4-[[(5R,9S)-2,6-dioxaspiro[4.5]decan-9-yl]amino]-2-methyl-3,5-dinitrophenyl]methanol (PubChem CID 99780718) has the molecular formula C16H21N3O7 and a molecular weight of 367.36 g/mol. Its IUPAC name is [4-[[(5R,9S)-2,6-dioxaspiro[4.5]decan-9-yl]amino]-2-methyl-3,5-dinitrophenyl]methanol.
| Compound Name | [4-[[(5R,9S)-2,6-dioxaspiro[4.5]decan-9-yl]amino]-2-methyl-3,5-dinitrophenyl]methanol |
|---|---|
| PubChem CID | 99780718 |
| Molecular Formula | C16H21N3O7 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [4-[[(5R,9S)-2,6-dioxaspiro[4.5]decan-9-yl]amino]-2-methyl-3,5-dinitrophenyl]methanol |
| SMILES | Cc1c(CO)cc([N+](=O)[O-])c(N[C@H]2CCO[C@@]3(CCOC3)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21N3O7/c1-10-11(8-20)6-13(18(21)22)14(15(10)19(23)24)17-12-2-4-26-16(7-12)3-5-25-9-16/h6,12,17,20H,2-5,7-9H2,1H3/t12-,16-/m0/s1 |
| InChIKey | YDZDWYXSWQBOEA-LRDDRELGSA-N |
| XLogP | 2.05 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|