C16H21Br2NO2 — CID 79902165
N-(2,6-dibromo-4-methylphenyl)-1,9-dioxaspiro[5.5]undecan-4-amine (PubChem CID 79902165) has the molecular formula C16H21Br2NO2 and a molecular weight of 419.16 g/mol. Its IUPAC name is N-(2,6-dibromo-4-methylphenyl)-1,9-dioxaspiro[5.5]undecan-4-amine.
| Compound Name | N-(2,6-dibromo-4-methylphenyl)-1,9-dioxaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 79902165 |
| Molecular Formula | C16H21Br2NO2 |
| Molecular Weight | 419.16 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | N-(2,6-dibromo-4-methylphenyl)-1,9-dioxaspiro[5.5]undecan-4-amine |
| SMILES | Cc1cc(Br)c(NC2CCOC3(CCOCC3)C2)c(Br)c1 |
| InChI | InChI=1S/C16H21Br2NO2/c1-11-8-13(17)15(14(18)9-11)19-12-2-5-21-16(10-12)3-6-20-7-4-16/h8-9,12,19H,2-7,10H2,1H3 |
| InChIKey | RNTSGOGWOZFDIM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.16 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |